C35H46O5Si — CID 10984700
diethyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]propanedioate (PubChem CID 10984700) has the molecular formula C35H46O5Si and a molecular weight of 574.83 g/mol. Its IUPAC name is diethyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]propanedioate.
| Compound Name | diethyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]propanedioate |
|---|---|
| PubChem CID | 10984700 |
| Molecular Formula | C35H46O5Si |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | diethyl 2-[(1S,3aS,6aS)-3a-methyl-6-methylidene-1,4,5,6a-tetrahydropentalen-1-yl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]propanedioate |
| SMILES | C=C1CC[C@@]2(C)C=C[C@H](C(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)(C(=O)OCC)C(=O)OCC)[C@@H]12 |
| InChI | InChI=1S/C35H46O5Si/c1-8-38-31(36)35(32(37)39-9-2,29-21-23-34(7)22-20-26(3)30(29)34)24-25-40-41(33(4,5)6,27-16-12-10-13-17-27)28-18-14-11-15-19-28/h10-19,21,23,29-30H,3,8-9,20,22,24-25H2,1-2,4-7H3/t29-,30+,34-/m0/s1 |
| InChIKey | QYDRUBVGUHZWDE-LITRCPILSA-N |
| XLogP | 6.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|