C29H42O5Si2 — CID 15473513
cis-dimethyl (3S,4S)-3-[[[tert-butyl(diphenyl)silyl]oxy-dimethylsilyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate (PubChem CID 15473513) has the molecular formula C29H42O5Si2 and a molecular weight of 526.82 g/mol. Its IUPAC name is cis-dimethyl (3S,4S)-3-[[[tert-butyl(diphenyl)silyl]oxy-dimethylsilyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3S,4S)-3-[[[tert-butyl(diphenyl)silyl]oxy-dimethylsilyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15473513 |
| Molecular Formula | C29H42O5Si2 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | cis-dimethyl (3S,4S)-3-[[[tert-butyl(diphenyl)silyl]oxy-dimethylsilyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](C[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C29H42O5Si2/c1-22-19-29(26(30)32-5,27(31)33-6)20-23(22)21-35(7,8)34-36(28(2,3)4,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,22-23H,19-21H2,1-8H3/t22-,23+/m0/s1 |
| InChIKey | MGMMXZJGFJKWES-XZOQPEGZSA-N |
| XLogP | 5.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|