C26H32O5Si — CID 102409804
methyl (3aR,5R,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 102409804) has the molecular formula C26H32O5Si and a molecular weight of 452.62 g/mol. Its IUPAC name is methyl (3aR,5R,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | methyl (3aR,5R,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 102409804 |
| Molecular Formula | C26H32O5Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | methyl (3aR,5R,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]1COC2=O |
| InChI | InChI=1S/C26H32O5Si/c1-25(2,3)32(21-11-7-5-8-12-21,22-13-9-6-10-14-22)31-17-19-15-20-18-30-24(28)26(20,16-19)23(27)29-4/h5-14,19-20H,15-18H2,1-4H3/t19-,20-,26-/m1/s1 |
| InChIKey | YOPQOTFSIRNHBF-XMERXJNXSA-N |
| XLogP | 3.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|