C29H36O5Si — CID 135068538
methyl (1R,4S,7S,9S,10R)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-4-carboxylate (PubChem CID 135068538) has the molecular formula C29H36O5Si and a molecular weight of 492.69 g/mol. Its IUPAC name is methyl (1R,4S,7S,9S,10R)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-4-carboxylate.
| Compound Name | methyl (1R,4S,7S,9S,10R)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-4-carboxylate |
|---|---|
| PubChem CID | 135068538 |
| Molecular Formula | C29H36O5Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | methyl (1R,4S,7S,9S,10R)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-4-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@H]3C[C@@H](CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@@H](OC1=O)[C@H]32 |
| InChI | InChI=1S/C29H36O5Si/c1-28(2,3)35(22-11-7-5-8-12-22,23-13-9-6-10-14-23)33-18-16-21-19-20-15-17-29(26(30)32-4)24(20)25(21)34-27(29)31/h5-14,20-21,24-25H,15-19H2,1-4H3/t20-,21+,24-,25+,29-/m0/s1 |
| InChIKey | UGRJDIHOZRFLAC-IHHMQXQNSA-N |
| XLogP | 4.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|