C29H38O5Si — CID 135069456
ethyl (3aR,5S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethyl-1-oxo-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate (PubChem CID 135069456) has the molecular formula C29H38O5Si and a molecular weight of 494.70 g/mol. Its IUPAC name is ethyl (3aR,5S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethyl-1-oxo-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate.
| Compound Name | ethyl (3aR,5S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethyl-1-oxo-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate |
|---|---|
| PubChem CID | 135069456 |
| Molecular Formula | C29H38O5Si |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | ethyl (3aR,5S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethyl-1-oxo-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]1C(C)(C)OC2=O |
| InChI | InChI=1S/C29H38O5Si/c1-7-32-25(30)29-19-21(18-24(29)28(5,6)34-26(29)31)20-33-35(27(2,3)4,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24H,7,18-20H2,1-6H3/t21-,24-,29-/m0/s1 |
| InChIKey | VPCYDFMIQKDOLL-OYYXRSNLSA-N |
| XLogP | 4.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|