C33H44O6Si — CID 102409805
methyl (1S,3aS,5S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(E)-hept-1-enyl]-5-hydroxy-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 102409805) has the molecular formula C33H44O6Si and a molecular weight of 564.80 g/mol. Its IUPAC name is methyl (1S,3aS,5S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(E)-hept-1-enyl]-5-hydroxy-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | methyl (1S,3aS,5S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(E)-hept-1-enyl]-5-hydroxy-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 102409805 |
| Molecular Formula | C33H44O6Si |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | methyl (1S,3aS,5S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(E)-hept-1-enyl]-5-hydroxy-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | CCCCC/C=C/[C@@H]1OC(=O)[C@@]2(C(=O)OC)C[C@H](O)[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C33H44O6Si/c1-6-7-8-9-16-21-28-29-26(27(34)22-33(29,30(35)37-5)31(36)39-28)23-38-40(32(2,3)4,24-17-12-10-13-18-24)25-19-14-11-15-20-25/h10-21,26-29,34H,6-9,22-23H2,1-5H3/b21-16+/t26-,27-,28-,29-,33-/m0/s1 |
| InChIKey | XQUIZSQYZNBLQW-DZNWMHPDSA-N |
| XLogP | 4.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|