C32H40O5Si — CID 135069458
(1S,4S,5R,6S,7S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(E)-hept-1-enyl]-3,8-dioxatricyclo[5.2.1.01,5]decane-2,9-dione (PubChem CID 135069458) has the molecular formula C32H40O5Si and a molecular weight of 532.75 g/mol. Its IUPAC name is (1S,4S,5R,6S,7S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(E)-hept-1-enyl]-3,8-dioxatricyclo[5.2.1.01,5]decane-2,9-dione.
| Compound Name | (1S,4S,5R,6S,7S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(E)-hept-1-enyl]-3,8-dioxatricyclo[5.2.1.01,5]decane-2,9-dione |
|---|---|
| PubChem CID | 135069458 |
| Molecular Formula | C32H40O5Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (1S,4S,5R,6S,7S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(E)-hept-1-enyl]-3,8-dioxatricyclo[5.2.1.01,5]decane-2,9-dione |
| SMILES | CCCCC/C=C/[C@@H]1OC(=O)[C@]23C[C@H](OC2=O)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]13 |
| InChI | InChI=1S/C32H40O5Si/c1-5-6-7-8-15-20-26-28-25(27-21-32(28,29(33)36-26)30(34)37-27)22-35-38(31(2,3)4,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-20,25-28H,5-8,21-22H2,1-4H3/b20-15+/t25-,26-,27-,28-,32+/m0/s1 |
| InChIKey | MWZYLHBDCFMFLR-WYZGENKISA-N |
| XLogP | 5.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|