C34H46O4Si — CID 10626409
[(E,1R)-1-[(1S,3aS,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]oct-2-enyl] acetate (PubChem CID 10626409) has the molecular formula C34H46O4Si and a molecular weight of 546.82 g/mol. Its IUPAC name is [(E,1R)-1-[(1S,3aS,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]oct-2-enyl] acetate.
| Compound Name | [(E,1R)-1-[(1S,3aS,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]oct-2-enyl] acetate |
|---|---|
| PubChem CID | 10626409 |
| Molecular Formula | C34H46O4Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | [(E,1R)-1-[(1S,3aS,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalen-1-yl]oct-2-enyl] acetate |
| SMILES | CCCCC/C=C/[C@@H](OC(C)=O)[C@H]1C(=O)C[C@@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C34H46O4Si/c1-6-7-8-9-16-21-32(37-25(2)35)33-30-24-27(22-26(30)23-31(33)36)38-39(34(3,4)5,28-17-12-10-13-18-28)29-19-14-11-15-20-29/h10-21,26-27,30,32-33H,6-9,22-24H2,1-5H3/b21-16+/t26-,27-,30-,32+,33+/m0/s1 |
| InChIKey | OKKLIHONJCIWEX-SYHMCGOMSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|