C24H28O4Si — CID 134878229
(3aR,4S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione (PubChem CID 134878229) has the molecular formula C24H28O4Si and a molecular weight of 408.57 g/mol. Its IUPAC name is (3aR,4S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione.
| Compound Name | (3aR,4S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione |
|---|---|
| PubChem CID | 134878229 |
| Molecular Formula | C24H28O4Si |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (3aR,4S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2,5-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1C(=O)C[C@@H]2OC(=O)C[C@@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O4Si/c1-24(2,3)29(17-10-6-4-7-11-17,18-12-8-5-9-13-18)27-16-20-19-14-23(26)28-22(19)15-21(20)25/h4-13,19-20,22H,14-16H2,1-3H3/t19-,20-,22+/m1/s1 |
| InChIKey | KBNMQQLVMCGQQY-SJBKTWHCSA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|