C14H15Cl3 — CID 107384023
3-chloro-1-[(2,5-dichlorophenyl)methyl]cycloheptene (PubChem CID 107384023) has the molecular formula C14H15Cl3 and a molecular weight of 289.63 g/mol. Its IUPAC name is 3-chloro-1-[(2,5-dichlorophenyl)methyl]cycloheptene.
| Compound Name | 3-chloro-1-[(2,5-dichlorophenyl)methyl]cycloheptene |
|---|---|
| PubChem CID | 107384023 |
| Molecular Formula | C14H15Cl3 |
| Molecular Weight | 289.63 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 3-chloro-1-[(2,5-dichlorophenyl)methyl]cycloheptene |
| SMILES | Clc1ccc(Cl)c(CC2=CC(Cl)CCCC2)c1 |
| InChI | InChI=1S/C14H15Cl3/c15-12-4-2-1-3-10(8-12)7-11-9-13(16)5-6-14(11)17/h5-6,8-9,12H,1-4,7H2 |
| InChIKey | UZNHDHAUBPAFLN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|