C17H24N2 — CID 107384139
N-ethyl-1,4-dimethyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-amine (PubChem CID 107384139) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-ethyl-1,4-dimethyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-amine.
| Compound Name | N-ethyl-1,4-dimethyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-amine |
|---|---|
| PubChem CID | 107384139 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-ethyl-1,4-dimethyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-amine |
| SMILES | CCNC1CCCCc2[nH]c3c(C)ccc(C)c3c21 |
| InChI | InChI=1S/C17H24N2/c1-4-18-13-7-5-6-8-14-16(13)15-11(2)9-10-12(3)17(15)19-14/h9-10,13,18-19H,4-8H2,1-3H3 |
| InChIKey | BOYKCXMZMAMNNB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |