C19H28N2 — CID 65332594
2,2,5,8-tetramethyl-N-propyl-1,3,4,9-tetrahydrocarbazol-4-amine (PubChem CID 65332594) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2,2,5,8-tetramethyl-N-propyl-1,3,4,9-tetrahydrocarbazol-4-amine.
| Compound Name | 2,2,5,8-tetramethyl-N-propyl-1,3,4,9-tetrahydrocarbazol-4-amine |
|---|---|
| PubChem CID | 65332594 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2,2,5,8-tetramethyl-N-propyl-1,3,4,9-tetrahydrocarbazol-4-amine |
| SMILES | CCCNC1CC(C)(C)Cc2[nH]c3c(C)ccc(C)c3c21 |
| InChI | InChI=1S/C19H28N2/c1-6-9-20-14-10-19(4,5)11-15-17(14)16-12(2)7-8-13(3)18(16)21-15/h7-8,14,20-21H,6,9-11H2,1-5H3 |
| InChIKey | GRQBTTRNQGDQFZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |