C23H42O4 — CID 10738698
(2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-7-methyl-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 10738698) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-7-methyl-1,4-dioxaspiro[4.5]dec-6-ene.
| Compound Name | (2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-7-methyl-1,4-dioxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 10738698 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-7-methyl-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | CC1=CC2(CCC1)O[C@@H](COC(C)(C)C(C)C)[C@H](COC(C)(C)C(C)C)O2 |
| InChI | InChI=1S/C23H42O4/c1-16(2)21(6,7)24-14-19-20(15-25-22(8,9)17(3)4)27-23(26-19)12-10-11-18(5)13-23/h13,16-17,19-20H,10-12,14-15H2,1-9H3/t19-,20-/m0/s1 |
| InChIKey | XBEGYLPTUQPMCS-PMACEKPBSA-N |
| XLogP | 5.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|