C22H40O4 — CID 10809072
(2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene (PubChem CID 10809072) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene.
| Compound Name | (2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene |
|---|---|
| PubChem CID | 10809072 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (2S,3S)-2,3-bis(2,3-dimethylbutan-2-yloxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene |
| SMILES | CC1=CCCC12O[C@@H](COC(C)(C)C(C)C)[C@H](COC(C)(C)C(C)C)O2 |
| InChI | InChI=1S/C22H40O4/c1-15(2)20(6,7)23-13-18-19(14-24-21(8,9)16(3)4)26-22(25-18)12-10-11-17(22)5/h11,15-16,18-19H,10,12-14H2,1-9H3/t18-,19-/m0/s1 |
| InChIKey | XVMXZVZPNGWPDC-OALUTQOASA-N |
| XLogP | 5.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|