C17H26O3 — CID 102574887
(8R,9R)-9-[(1E)-2,6-dimethylhepta-1,5-dienyl]-8-methoxy-1,4-dioxaspiro[4.4]non-6-ene (PubChem CID 102574887) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (8R,9R)-9-[(1E)-2,6-dimethylhepta-1,5-dienyl]-8-methoxy-1,4-dioxaspiro[4.4]non-6-ene.
| Compound Name | (8R,9R)-9-[(1E)-2,6-dimethylhepta-1,5-dienyl]-8-methoxy-1,4-dioxaspiro[4.4]non-6-ene |
|---|---|
| PubChem CID | 102574887 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (8R,9R)-9-[(1E)-2,6-dimethylhepta-1,5-dienyl]-8-methoxy-1,4-dioxaspiro[4.4]non-6-ene |
| SMILES | CO[C@@H]1C=CC2(OCCO2)[C@@H]1/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H26O3/c1-13(2)6-5-7-14(3)12-15-16(18-4)8-9-17(15)19-10-11-20-17/h6,8-9,12,15-16H,5,7,10-11H2,1-4H3/b14-12+/t15-,16-/m1/s1 |
| InChIKey | KYKQWLRPYUROCZ-XRZYUTHKSA-N |
| XLogP | 3.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|