C20H36O3 — CID 11313349
(6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-6-nonyl-2,5-dihydropyran (PubChem CID 11313349) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-6-nonyl-2,5-dihydropyran.
| Compound Name | (6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-6-nonyl-2,5-dihydropyran |
|---|---|
| PubChem CID | 11313349 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-6-nonyl-2,5-dihydropyran |
| SMILES | CCCCCCCCC[C@]1([C@H]2COC(C)(C)O2)CC=C(C)CO1 |
| InChI | InChI=1S/C20H36O3/c1-5-6-7-8-9-10-11-13-20(14-12-17(2)15-22-20)18-16-21-19(3,4)23-18/h12,18H,5-11,13-16H2,1-4H3/t18-,20-/m1/s1 |
| InChIKey | GKRQBNVROUYFAH-UYAOXDASSA-N |
| XLogP | 5.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|