C15H22N2O2 — CID 107387425
4-[2-(1,2,3,4-tetrahydroquinolin-3-yloxy)ethyl]morpholine (PubChem CID 107387425) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-[2-(1,2,3,4-tetrahydroquinolin-3-yloxy)ethyl]morpholine.
| Compound Name | 4-[2-(1,2,3,4-tetrahydroquinolin-3-yloxy)ethyl]morpholine |
|---|---|
| PubChem CID | 107387425 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-[2-(1,2,3,4-tetrahydroquinolin-3-yloxy)ethyl]morpholine |
| SMILES | c1ccc2c(c1)CC(OCCN1CCOCC1)CN2 |
| InChI | InChI=1S/C15H22N2O2/c1-2-4-15-13(3-1)11-14(12-16-15)19-10-7-17-5-8-18-9-6-17/h1-4,14,16H,5-12H2 |
| InChIKey | WNTDMWCAKBZXKT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |