C21H42O4Si — CID 10738933
[(2R,3S,4S)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentyl] 2,2-dimethylpropanoate (PubChem CID 10738933) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is [(2R,3S,4S)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10738933 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | [(2R,3S,4S)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentyl] 2,2-dimethylpropanoate |
| SMILES | CC(C=O)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si/c1-14(2)26(15(3)4,16(5)6)25-19(17(7)12-22)18(8)13-24-20(23)21(9,10)11/h12,14-19H,13H2,1-11H3/t17?,18-,19-/m1/s1 |
| InChIKey | HMKCLITVQQDROJ-OMKBGSMGSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|