C24H32FNO3 — CID 10739820
N-[2-[(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-8-yl)oxy]ethyl]-4-(4-methoxyphenyl)butan-1-amine (PubChem CID 10739820) has the molecular formula C24H32FNO3 and a molecular weight of 401.52 g/mol. Its IUPAC name is N-[2-[(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-8-yl)oxy]ethyl]-4-(4-methoxyphenyl)butan-1-amine.
| Compound Name | N-[2-[(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-8-yl)oxy]ethyl]-4-(4-methoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 10739820 |
| Molecular Formula | C24H32FNO3 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-[2-[(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-8-yl)oxy]ethyl]-4-(4-methoxyphenyl)butan-1-amine |
| SMILES | COc1ccc(CCCCNCCOc2cc(F)cc3c2OC(C)(C)CC3)cc1 |
| InChI | InChI=1S/C24H32FNO3/c1-24(2)12-11-19-16-20(25)17-22(23(19)29-24)28-15-14-26-13-5-4-6-18-7-9-21(27-3)10-8-18/h7-10,16-17,26H,4-6,11-15H2,1-3H3 |
| InChIKey | LXKQQGFVXIEZTH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|