C19H22FNO4S — CID 34161635
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 34161635) has the molecular formula C19H22FNO4S and a molecular weight of 379.45 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 34161635 |
| Molecular Formula | C19H22FNO4S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | CC1(C)Cc2cccc(OCCNS(=O)(=O)Cc3ccc(F)cc3)c2O1 |
| InChI | InChI=1S/C19H22FNO4S/c1-19(2)12-15-4-3-5-17(18(15)25-19)24-11-10-21-26(22,23)13-14-6-8-16(20)9-7-14/h3-9,21H,10-13H2,1-2H3 |
| InChIKey | LJNPRYJDJWJMBW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|