C9H9N3O3 — CID 107409902
4-[(4-hydroxyphenyl)methyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 107409902) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)methyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[(4-hydroxyphenyl)methyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409902 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-[(4-hydroxyphenyl)methyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H9N3O3/c13-7-3-1-6(2-4-7)5-12-8(14)10-11-9(12)15/h1-4,13H,5H2,(H,10,14)(H,11,15) |
| InChIKey | MXJGIEVTLKYCGC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |