2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid

C11H11N3O3 — CID 107410215

IUPAC2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid
SMILESO=C(O)C(Cc1ccccc1)n1cn[nH]c1=O
InChIInChI=1S/C11H11N3O3/c15-10(16)9(14-7-12-13-11(14)17)6-8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,13,17)(H,15,16)
InChIKeyTUWNOORJGWJJMJ-UHFFFAOYSA-N
MW233.23 g/mol
LogP0.44
Rot. Bonds4

About 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid

2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid (PubChem CID 107410215) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid.

Molecular Properties

Compound Name2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid
PubChem CID107410215
Molecular FormulaC11H11N3O3
Molecular Weight233.23 g/mol
Exact Mass233.08
IUPAC Name2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid
SMILESO=C(O)C(Cc1ccccc1)n1cn[nH]c1=O
InChIInChI=1S/C11H11N3O3/c15-10(16)9(14-7-12-13-11(14)17)6-8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,13,17)(H,15,16)
InChIKeyTUWNOORJGWJJMJ-UHFFFAOYSA-N
XLogP0.44
TPSA87.98 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.23
LogP ≤ 50.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid?
The IUPAC name of 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid (CID 107410215) is 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid.
What is the SMILES notation for 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid?
The canonical SMILES for 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid is O=C(O)C(Cc1ccccc1)n1cn[nH]c1=O.
What is the InChIKey of 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid?
The InChIKey is TUWNOORJGWJJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c15-10(16)9(14-7-12-13-11(14)17)6-8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,13,17)(H,15,16).
What are the key properties of 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid?
2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid has a molecular weight of 233.23 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1H-1,2,4-triazol-4-yl)-3-phenylpropanoic acid is sourced from PubChem (CID 107410215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).