C6H7N3O — CID 107410930
4-but-3-yn-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 107410930) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is 4-but-3-yn-2-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-but-3-yn-2-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 107410930 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 4-but-3-yn-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | C#CC(C)n1cn[nH]c1=O |
| InChI | InChI=1S/C6H7N3O/c1-3-5(2)9-4-7-8-6(9)10/h1,4-5H,2H3,(H,8,10) |
| InChIKey | QCEDACAITWORGS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|