C12H14ClF3N2O2S — CID 107423180
2-chloro-N-(3-methylpyrrolidin-3-yl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 107423180) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is 2-chloro-N-(3-methylpyrrolidin-3-yl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(3-methylpyrrolidin-3-yl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107423180 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-chloro-N-(3-methylpyrrolidin-3-yl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CCNC1 |
| InChI | InChI=1S/C12H14ClF3N2O2S/c1-11(4-5-17-7-11)18-21(19,20)10-6-8(12(14,15)16)2-3-9(10)13/h2-3,6,17-18H,4-5,7H2,1H3 |
| InChIKey | YTARLVZBRJTAGL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |