C24H28N4O3 — CID 10742481
(2S)-2-amino-N-[3-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)propyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 10742481) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)propyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[3-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)propyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 10742481 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (2S)-2-amino-N-[3-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)propyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | Cc1nc(CCCNC(=O)[C@@H](N)Cc2ccc(O)cc2)c(=O)[nH]c1Cc1ccccc1 |
| InChI | InChI=1S/C24H28N4O3/c1-16-22(15-17-6-3-2-4-7-17)28-24(31)21(27-16)8-5-13-26-23(30)20(25)14-18-9-11-19(29)12-10-18/h2-4,6-7,9-12,20,29H,5,8,13-15,25H2,1H3,(H,26,30)(H,28,31)/t20-/m0/s1 |
| InChIKey | PHRGRHTXPVCSQV-FQEVSTJZSA-N |
| XLogP | 1.99 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|