C25H30N4O3 — CID 10838123
(2S)-2-amino-N-[4-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)butyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 10838123) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)butyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[4-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)butyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 10838123 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (2S)-2-amino-N-[4-(6-benzyl-5-methyl-2-oxo-1H-pyrazin-3-yl)butyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | Cc1nc(CCCCNC(=O)[C@@H](N)Cc2ccc(O)cc2)c(=O)[nH]c1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N4O3/c1-17-23(16-18-7-3-2-4-8-18)29-25(32)22(28-17)9-5-6-14-27-24(31)21(26)15-19-10-12-20(30)13-11-19/h2-4,7-8,10-13,21,30H,5-6,9,14-16,26H2,1H3,(H,27,31)(H,29,32)/t21-/m0/s1 |
| InChIKey | AZLIDIARVOUAOC-NRFANRHFSA-N |
| XLogP | 2.38 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|