C13H12F3NO — CID 107431853
1-(2-ethyl-4,5,6-trifluoro-1H-indol-3-yl)propan-1-one (PubChem CID 107431853) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-(2-ethyl-4,5,6-trifluoro-1H-indol-3-yl)propan-1-one.
| Compound Name | 1-(2-ethyl-4,5,6-trifluoro-1H-indol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 107431853 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-(2-ethyl-4,5,6-trifluoro-1H-indol-3-yl)propan-1-one |
| SMILES | CCC(=O)c1c(CC)[nH]c2cc(F)c(F)c(F)c12 |
| InChI | InChI=1S/C13H12F3NO/c1-3-7-10(9(18)4-2)11-8(17-7)5-6(14)12(15)13(11)16/h5,17H,3-4H2,1-2H3 |
| InChIKey | XGUPQVCVADNYIH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|