C12H12N2O4S — CID 107433013
5-oxo-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazine-2-carboxylic acid (PubChem CID 107433013) has the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-oxo-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazine-2-carboxylic acid.
| Compound Name | 5-oxo-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107433013 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-oxo-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)/C=C/c2cccs2)C(C(=O)O)CN1 |
| InChI | InChI=1S/C12H12N2O4S/c15-10-7-14(9(6-13-10)12(17)18)11(16)4-3-8-2-1-5-19-8/h1-5,9H,6-7H2,(H,13,15)(H,17,18)/b4-3+ |
| InChIKey | KOYGTBUTPXXTRP-ONEGZZNKSA-N |
| XLogP | 0.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|