C22H36N6O6 — CID 10743349
(2S)-N-[5-[3-(3-aminopropylamino)propanoylamino]pentyl]-2-[(2,4-dihydroxybenzoyl)amino]butanediamide (PubChem CID 10743349) has the molecular formula C22H36N6O6 and a molecular weight of 480.57 g/mol. Its IUPAC name is (2S)-N-[5-[3-(3-aminopropylamino)propanoylamino]pentyl]-2-[(2,4-dihydroxybenzoyl)amino]butanediamide.
| Compound Name | (2S)-N-[5-[3-(3-aminopropylamino)propanoylamino]pentyl]-2-[(2,4-dihydroxybenzoyl)amino]butanediamide |
|---|---|
| PubChem CID | 10743349 |
| Molecular Formula | C22H36N6O6 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (2S)-N-[5-[3-(3-aminopropylamino)propanoylamino]pentyl]-2-[(2,4-dihydroxybenzoyl)amino]butanediamide |
| SMILES | NCCCNCCC(=O)NCCCCCNC(=O)[C@H](CC(N)=O)NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C22H36N6O6/c23-8-4-9-25-12-7-20(32)26-10-2-1-3-11-27-22(34)17(14-19(24)31)28-21(33)16-6-5-15(29)13-18(16)30/h5-6,13,17,25,29-30H,1-4,7-12,14,23H2,(H2,24,31)(H,26,32)(H,27,34)(H,28,33)/t17-/m0/s1 |
| InChIKey | LYJBBASWZWEBBB-KRWDZBQOSA-N |
| XLogP | -1.20 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|