C8H14N2O5 — CID 107433829
2-[(2-amino-2-oxoethyl)-(3-methoxypropanoyl)amino]acetic acid (PubChem CID 107433829) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(3-methoxypropanoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(3-methoxypropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107433829 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(3-methoxypropanoyl)amino]acetic acid |
| SMILES | COCCC(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-15-3-2-7(12)10(4-6(9)11)5-8(13)14/h2-5H2,1H3,(H2,9,11)(H,13,14) |
| InChIKey | NQODYTFGEHVAQD-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |