C16H32N2O2S2 — CID 107446153
tert-butyl N-tert-butyl-N-[2-(1,4-dithian-2-ylmethylamino)ethyl]carbamate (PubChem CID 107446153) has the molecular formula C16H32N2O2S2 and a molecular weight of 348.58 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(1,4-dithian-2-ylmethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(1,4-dithian-2-ylmethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107446153 |
| Molecular Formula | C16H32N2O2S2 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(1,4-dithian-2-ylmethylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNCC1CSCCS1)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O2S2/c1-15(2,3)18(14(19)20-16(4,5)6)8-7-17-11-13-12-21-9-10-22-13/h13,17H,7-12H2,1-6H3 |
| InChIKey | UTYLETOLIKFINQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|