C18H24N2O — CID 107448333
4-(1,3-oxazol-5-yl)-N-(3-propan-2-ylcyclohexyl)aniline (PubChem CID 107448333) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-(1,3-oxazol-5-yl)-N-(3-propan-2-ylcyclohexyl)aniline.
| Compound Name | 4-(1,3-oxazol-5-yl)-N-(3-propan-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107448333 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4-(1,3-oxazol-5-yl)-N-(3-propan-2-ylcyclohexyl)aniline |
| SMILES | CC(C)C1CCCC(Nc2ccc(-c3cnco3)cc2)C1 |
| InChI | InChI=1S/C18H24N2O/c1-13(2)15-4-3-5-17(10-15)20-16-8-6-14(7-9-16)18-11-19-12-21-18/h6-9,11-13,15,17,20H,3-5,10H2,1-2H3 |
| InChIKey | YWWYBYBMPUNEMF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |