C18H22N2O — CID 64623155
N-(3-cyclopropylcyclohexyl)-4-(1,3-oxazol-5-yl)aniline (PubChem CID 64623155) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(3-cyclopropylcyclohexyl)-4-(1,3-oxazol-5-yl)aniline.
| Compound Name | N-(3-cyclopropylcyclohexyl)-4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 64623155 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(3-cyclopropylcyclohexyl)-4-(1,3-oxazol-5-yl)aniline |
| SMILES | c1ncc(-c2ccc(NC3CCCC(C4CC4)C3)cc2)o1 |
| InChI | InChI=1S/C18H22N2O/c1-2-15(13-4-5-13)10-17(3-1)20-16-8-6-14(7-9-16)18-11-19-12-21-18/h6-9,11-13,15,17,20H,1-5,10H2 |
| InChIKey | PUZRUBYCNSHCBT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |