C12H16F2N2O4S — CID 107477899
3-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-methylsulfonylbenzamide (PubChem CID 107477899) has the molecular formula C12H16F2N2O4S and a molecular weight of 322.33 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-methylsulfonylbenzamide.
| Compound Name | 3-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 107477899 |
| Molecular Formula | C12H16F2N2O4S |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(N)cc(C(=O)N(CCO)CC(F)F)c1 |
| InChI | InChI=1S/C12H16F2N2O4S/c1-21(19,20)10-5-8(4-9(15)6-10)12(18)16(2-3-17)7-11(13)14/h4-6,11,17H,2-3,7,15H2,1H3 |
| InChIKey | LRGMJSSVQBIDMA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|