About 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile
6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile (PubChem CID 107479668) has the molecular formula C12H22F2N2O
and a molecular weight of 248.32 g/mol. Its IUPAC name is 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile |
| PubChem CID | 107479668 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C12H22F2N2O/c1-12(2,10-15)5-3-4-6-16(7-8-17)9-11(13)14/h11,17H,3-9H2,1-2H3 |
| InChIKey | AOZQGOWENXBKBL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile?
The IUPAC name of 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile (CID 107479668) is 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile.
What is the SMILES notation for 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile?
The canonical SMILES for 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile is CC(C)(C#N)CCCCN(CCO)CC(F)F.
What is the InChIKey of 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile?
The InChIKey is AOZQGOWENXBKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O/c1-12(2,10-15)5-3-4-6-16(7-8-17)9-11(13)14/h11,17H,3-9H2,1-2H3.
What are the key properties of 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile?
6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile has a molecular weight of 248.32 g/mol, XLogP of 2.27, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile is sourced from PubChem (CID 107479668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).