C12H22F2N2O — CID 107479668
6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile (PubChem CID 107479668) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 107479668 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 6-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C12H22F2N2O/c1-12(2,10-15)5-3-4-6-16(7-8-17)9-11(13)14/h11,17H,3-9H2,1-2H3 |
| InChIKey | AOZQGOWENXBKBL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|