C9H14BrF2N3S — CID 107489529
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 107489529) has the molecular formula C9H14BrF2N3S and a molecular weight of 314.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107489529 |
| Molecular Formula | C9H14BrF2N3S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)c1nsc(N(CCBr)CC(F)F)n1 |
| InChI | InChI=1S/C9H14BrF2N3S/c1-6(2)8-13-9(16-14-8)15(4-3-10)5-7(11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | FKLNLOMMKIGBTM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|