C10H14BrF2N3OS — CID 107491726
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 107491726) has the molecular formula C10H14BrF2N3OS and a molecular weight of 342.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107491726 |
| Molecular Formula | C10H14BrF2N3OS |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)N(CCBr)CC(F)F |
| InChI | InChI=1S/C10H14BrF2N3OS/c1-6(2)8-9(18-15-14-8)10(17)16(4-3-11)5-7(12)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | GYAVRCSCXVJVTK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|