C11H15BrF3N3OS — CID 107492664
N-(2-bromoethyl)-4-tert-butyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide (PubChem CID 107492664) has the molecular formula C11H15BrF3N3OS and a molecular weight of 374.23 g/mol. Its IUPAC name is N-(2-bromoethyl)-4-tert-butyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide.
| Compound Name | N-(2-bromoethyl)-4-tert-butyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107492664 |
| Molecular Formula | C11H15BrF3N3OS |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-(2-bromoethyl)-4-tert-butyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H15BrF3N3OS/c1-10(2,3)8-7(20-17-16-8)9(19)18(5-4-12)6-11(13,14)15/h4-6H2,1-3H3 |
| InChIKey | MHIXRQZVOZQFHW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|