C10H19BrF2N2O2S — CID 107492735
N-(2-bromoethyl)-N-(2,2-difluoroethyl)azepane-1-sulfonamide (PubChem CID 107492735) has the molecular formula C10H19BrF2N2O2S and a molecular weight of 349.24 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)azepane-1-sulfonamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 107492735 |
| Molecular Formula | C10H19BrF2N2O2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)azepane-1-sulfonamide |
| SMILES | O=S(=O)(N1CCCCCC1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C10H19BrF2N2O2S/c11-5-8-15(9-10(12)13)18(16,17)14-6-3-1-2-4-7-14/h10H,1-9H2 |
| InChIKey | PJJNCQBDIDKEGY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|