C10H19F2N3O — CID 107493756
1-(2-aminoethyl)-3-cyclopentyl-1-(2,2-difluoroethyl)urea (PubChem CID 107493756) has the molecular formula C10H19F2N3O and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-cyclopentyl-1-(2,2-difluoroethyl)urea.
| Compound Name | 1-(2-aminoethyl)-3-cyclopentyl-1-(2,2-difluoroethyl)urea |
|---|---|
| PubChem CID | 107493756 |
| Molecular Formula | C10H19F2N3O |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-(2-aminoethyl)-3-cyclopentyl-1-(2,2-difluoroethyl)urea |
| SMILES | NCCN(CC(F)F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H19F2N3O/c11-9(12)7-15(6-5-13)10(16)14-8-3-1-2-4-8/h8-9H,1-7,13H2,(H,14,16) |
| InChIKey | BCJUVOSJGQNDPB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |