C7H17F2N3O3S — CID 107493828
2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1-difluoroethane (PubChem CID 107493828) has the molecular formula C7H17F2N3O3S and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1-difluoroethane.
| Compound Name | 2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1-difluoroethane |
|---|---|
| PubChem CID | 107493828 |
| Molecular Formula | C7H17F2N3O3S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1-difluoroethane |
| SMILES | COCCNS(=O)(=O)N(CCN)CC(F)F |
| InChI | InChI=1S/C7H17F2N3O3S/c1-15-5-3-11-16(13,14)12(4-2-10)6-7(8)9/h7,11H,2-6,10H2,1H3 |
| InChIKey | BSUVBBQROACKOR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|