C7H16F3N3O3S — CID 107493915
2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1,1-trifluoroethane (PubChem CID 107493915) has the molecular formula C7H16F3N3O3S and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1,1-trifluoroethane.
| Compound Name | 2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 107493915 |
| Molecular Formula | C7H16F3N3O3S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[2-aminoethyl(2-methoxyethylsulfamoyl)amino]-1,1,1-trifluoroethane |
| SMILES | COCCNS(=O)(=O)N(CCN)CC(F)(F)F |
| InChI | InChI=1S/C7H16F3N3O3S/c1-16-5-3-12-17(14,15)13(4-2-11)6-7(8,9)10/h12H,2-6,11H2,1H3 |
| InChIKey | XVKOXSRMKMSUPL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|