C4H10F3N3O2S — CID 107493907
2-[2-aminoethyl(sulfamoyl)amino]-1,1,1-trifluoroethane (PubChem CID 107493907) has the molecular formula C4H10F3N3O2S and a molecular weight of 221.20 g/mol. Its IUPAC name is 2-[2-aminoethyl(sulfamoyl)amino]-1,1,1-trifluoroethane.
| Compound Name | 2-[2-aminoethyl(sulfamoyl)amino]-1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 107493907 |
| Molecular Formula | C4H10F3N3O2S |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-[2-aminoethyl(sulfamoyl)amino]-1,1,1-trifluoroethane |
| SMILES | NCCN(CC(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C4H10F3N3O2S/c5-4(6,7)3-10(2-1-8)13(9,11)12/h1-3,8H2,(H2,9,11,12) |
| InChIKey | PZRQHEHIFVTDCK-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |