C11H16O2 — CID 10749877
(1aS,4aR,5R,8aR)-4a-methyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol (PubChem CID 10749877) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1aS,4aR,5R,8aR)-4a-methyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol.
| Compound Name | (1aS,4aR,5R,8aR)-4a-methyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol |
|---|---|
| PubChem CID | 10749877 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1aS,4aR,5R,8aR)-4a-methyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol |
| SMILES | C[C@]12C=CC[C@@H]3O[C@@]31CCC[C@H]2O |
| InChI | InChI=1S/C11H16O2/c1-10-6-3-5-9-11(10,13-9)7-2-4-8(10)12/h3,6,8-9,12H,2,4-5,7H2,1H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | HKBJUBMZGIRZAB-YTWAJWBKSA-N |
| XLogP | 1.63 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|