About 3,4-diethyldec-3-en-5-yne
3,4-diethyldec-3-en-5-yne (PubChem CID 10750287) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 3,4-diethyldec-3-en-5-yne.
Molecular Properties
| Compound Name | 3,4-diethyldec-3-en-5-yne |
| PubChem CID | 10750287 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 3,4-diethyldec-3-en-5-yne |
| SMILES | CCCCC#CC(CC)=C(CC)CC |
| InChI | InChI=1S/C14H24/c1-5-9-10-11-12-14(8-4)13(6-2)7-3/h5-10H2,1-4H3 |
| InChIKey | DGMLKLKXKIIMDQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethyldec-3-en-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyldec-3-en-5-yne?
The IUPAC name of 3,4-diethyldec-3-en-5-yne (CID 10750287) is 3,4-diethyldec-3-en-5-yne.
What is the SMILES notation for 3,4-diethyldec-3-en-5-yne?
The canonical SMILES for 3,4-diethyldec-3-en-5-yne is CCCCC#CC(CC)=C(CC)CC.
What is the InChIKey of 3,4-diethyldec-3-en-5-yne?
The InChIKey is DGMLKLKXKIIMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-5-9-10-11-12-14(8-4)13(6-2)7-3/h5-10H2,1-4H3.
What are the key properties of 3,4-diethyldec-3-en-5-yne?
3,4-diethyldec-3-en-5-yne has a molecular weight of 192.35 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyldec-3-en-5-yne is sourced from PubChem (CID 10750287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).