C12H20O2Si — CID 10751640
trans-(1R,2R)-1-[2-(furan-2-yl)ethyl]-2-trimethylsilylcyclopropan-1-ol (PubChem CID 10751640) has the molecular formula C12H20O2Si and a molecular weight of 224.38 g/mol. Its IUPAC name is trans-(1R,2R)-1-[2-(furan-2-yl)ethyl]-2-trimethylsilylcyclopropan-1-ol.
| Compound Name | trans-(1R,2R)-1-[2-(furan-2-yl)ethyl]-2-trimethylsilylcyclopropan-1-ol |
|---|---|
| PubChem CID | 10751640 |
| Molecular Formula | C12H20O2Si |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | trans-(1R,2R)-1-[2-(furan-2-yl)ethyl]-2-trimethylsilylcyclopropan-1-ol |
| SMILES | C[Si](C)(C)[C@@H]1C[C@]1(O)CCc1ccco1 |
| InChI | InChI=1S/C12H20O2Si/c1-15(2,3)11-9-12(11,13)7-6-10-5-4-8-14-10/h4-5,8,11,13H,6-7,9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | HBAWQHDTNLOLAR-VXGBXAGGSA-N |
| XLogP | 3.06 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|