C13H23NO2 — CID 10751679
[(2E)-3,7-dimethylocta-2,6-dienyl] N-ethylcarbamate (PubChem CID 10751679) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] N-ethylcarbamate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 10751679 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H23NO2/c1-5-14-13(15)16-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3,(H,14,15)/b12-9+ |
| InChIKey | HRFOXRCMHSXKIK-FMIVXFBMSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|