C7H7N3O2S2 — CID 10751888
4-methyl-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazine-3-thione (PubChem CID 10751888) has the molecular formula C7H7N3O2S2 and a molecular weight of 229.29 g/mol. Its IUPAC name is 4-methyl-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazine-3-thione.
| Compound Name | 4-methyl-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazine-3-thione |
|---|---|
| PubChem CID | 10751888 |
| Molecular Formula | C7H7N3O2S2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 4-methyl-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazine-3-thione |
| SMILES | CN1C(=S)NS(=O)(=O)c2cnccc21 |
| InChI | InChI=1S/C7H7N3O2S2/c1-10-5-2-3-8-4-6(5)14(11,12)9-7(10)13/h2-4H,1H3,(H,9,13) |
| InChIKey | WVOBYUBSOATIGC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|