C10H12F6 — CID 10752919
1-(1,1,2,3,3,3-hexafluoropropyl)cycloheptene (PubChem CID 10752919) has the molecular formula C10H12F6 and a molecular weight of 246.19 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)cycloheptene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)cycloheptene |
|---|---|
| PubChem CID | 10752919 |
| Molecular Formula | C10H12F6 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)cycloheptene |
| SMILES | FC(C(F)(F)F)C(F)(F)C1=CCCCCC1 |
| InChI | InChI=1S/C10H12F6/c11-8(10(14,15)16)9(12,13)7-5-3-1-2-4-6-7/h5,8H,1-4,6H2 |
| InChIKey | SULLCXQNOCIKMK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|