C16H18O3 — CID 10753686
6-phenylmethoxy-1-oxaspiro[4.5]dec-3-en-2-one (PubChem CID 10753686) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-phenylmethoxy-1-oxaspiro[4.5]dec-3-en-2-one.
| Compound Name | 6-phenylmethoxy-1-oxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 10753686 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 6-phenylmethoxy-1-oxaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1C=CC2(CCCCC2OCc2ccccc2)O1 |
| InChI | InChI=1S/C16H18O3/c17-15-9-11-16(19-15)10-5-4-8-14(16)18-12-13-6-2-1-3-7-13/h1-3,6-7,9,11,14H,4-5,8,10,12H2 |
| InChIKey | CDECTOGAJNCGQC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |